C14H11F2NO5 — CID 90082113
[2-acetamido-5-(2,3-difluorophenyl)-4-hydroxyfuran-3-yl] acetate (PubChem CID 90082113) has the molecular formula C14H11F2NO5 and a molecular weight of 311.24 g/mol. Its IUPAC name is [2-acetamido-5-(2,3-difluorophenyl)-4-hydroxyfuran-3-yl] acetate.
| Compound Name | [2-acetamido-5-(2,3-difluorophenyl)-4-hydroxyfuran-3-yl] acetate |
|---|---|
| PubChem CID | 90082113 |
| Molecular Formula | C14H11F2NO5 |
| Molecular Weight | 311.24 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | [2-acetamido-5-(2,3-difluorophenyl)-4-hydroxyfuran-3-yl] acetate |
| SMILES | CC(=O)Nc1oc(-c2cccc(F)c2F)c(O)c1OC(C)=O |
| InChI | InChI=1S/C14H11F2NO5/c1-6(18)17-14-13(21-7(2)19)11(20)12(22-14)8-4-3-5-9(15)10(8)16/h3-5,20H,1-2H3,(H,17,18) |
| InChIKey | RVYOALRVRABZGD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |