C19H14ClNO5 — CID 90082257
[2-benzamido-5-(4-chlorophenyl)-4-hydroxyfuran-3-yl] acetate (PubChem CID 90082257) has the molecular formula C19H14ClNO5 and a molecular weight of 371.78 g/mol. Its IUPAC name is [2-benzamido-5-(4-chlorophenyl)-4-hydroxyfuran-3-yl] acetate.
| Compound Name | [2-benzamido-5-(4-chlorophenyl)-4-hydroxyfuran-3-yl] acetate |
|---|---|
| PubChem CID | 90082257 |
| Molecular Formula | C19H14ClNO5 |
| Molecular Weight | 371.78 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | [2-benzamido-5-(4-chlorophenyl)-4-hydroxyfuran-3-yl] acetate |
| SMILES | CC(=O)Oc1c(NC(=O)c2ccccc2)oc(-c2ccc(Cl)cc2)c1O |
| InChI | InChI=1S/C19H14ClNO5/c1-11(22)25-17-15(23)16(12-7-9-14(20)10-8-12)26-19(17)21-18(24)13-5-3-2-4-6-13/h2-10,23H,1H3,(H,21,24) |
| InChIKey | WFNHVZXNKPPPBO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.78 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |