C19H13ClFNO5 — CID 90082181
[2-benzamido-5-(3-chloro-4-fluorophenyl)-4-hydroxyfuran-3-yl] acetate (PubChem CID 90082181) has the molecular formula C19H13ClFNO5 and a molecular weight of 389.77 g/mol. Its IUPAC name is [2-benzamido-5-(3-chloro-4-fluorophenyl)-4-hydroxyfuran-3-yl] acetate.
| Compound Name | [2-benzamido-5-(3-chloro-4-fluorophenyl)-4-hydroxyfuran-3-yl] acetate |
|---|---|
| PubChem CID | 90082181 |
| Molecular Formula | C19H13ClFNO5 |
| Molecular Weight | 389.77 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | [2-benzamido-5-(3-chloro-4-fluorophenyl)-4-hydroxyfuran-3-yl] acetate |
| SMILES | CC(=O)Oc1c(NC(=O)c2ccccc2)oc(-c2ccc(F)c(Cl)c2)c1O |
| InChI | InChI=1S/C19H13ClFNO5/c1-10(23)26-17-15(24)16(12-7-8-14(21)13(20)9-12)27-19(17)22-18(25)11-5-3-2-4-6-11/h2-9,24H,1H3,(H,22,25) |
| InChIKey | WPHMHFHGWNYNPL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.77 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |