C16H13ClFNO5 — CID 90082090
[5-(4-chloro-3-fluorophenyl)-4-hydroxy-2-(2-oxopyrrolidin-1-yl)furan-3-yl] acetate (PubChem CID 90082090) has the molecular formula C16H13ClFNO5 and a molecular weight of 353.73 g/mol. Its IUPAC name is [5-(4-chloro-3-fluorophenyl)-4-hydroxy-2-(2-oxopyrrolidin-1-yl)furan-3-yl] acetate.
| Compound Name | [5-(4-chloro-3-fluorophenyl)-4-hydroxy-2-(2-oxopyrrolidin-1-yl)furan-3-yl] acetate |
|---|---|
| PubChem CID | 90082090 |
| Molecular Formula | C16H13ClFNO5 |
| Molecular Weight | 353.73 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | [5-(4-chloro-3-fluorophenyl)-4-hydroxy-2-(2-oxopyrrolidin-1-yl)furan-3-yl] acetate |
| SMILES | CC(=O)Oc1c(N2CCCC2=O)oc(-c2ccc(Cl)c(F)c2)c1O |
| InChI | InChI=1S/C16H13ClFNO5/c1-8(20)23-15-13(22)14(9-4-5-10(17)11(18)7-9)24-16(15)19-6-2-3-12(19)21/h4-5,7,22H,2-3,6H2,1H3 |
| InChIKey | PSXXHTFIWKDLCJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.73 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |