C16H17NO7 — CID 90082253
[2-(ethoxycarbonylamino)-4-hydroxy-5-(3-methoxyphenyl)furan-3-yl] acetate (PubChem CID 90082253) has the molecular formula C16H17NO7 and a molecular weight of 335.31 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-4-hydroxy-5-(3-methoxyphenyl)furan-3-yl] acetate.
| Compound Name | [2-(ethoxycarbonylamino)-4-hydroxy-5-(3-methoxyphenyl)furan-3-yl] acetate |
|---|---|
| PubChem CID | 90082253 |
| Molecular Formula | C16H17NO7 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | [2-(ethoxycarbonylamino)-4-hydroxy-5-(3-methoxyphenyl)furan-3-yl] acetate |
| SMILES | CCOC(=O)Nc1oc(-c2cccc(OC)c2)c(O)c1OC(C)=O |
| InChI | InChI=1S/C16H17NO7/c1-4-22-16(20)17-15-14(23-9(2)18)12(19)13(24-15)10-6-5-7-11(8-10)21-3/h5-8,19H,4H2,1-3H3,(H,17,20) |
| InChIKey | MGGHTNMGXWOPOS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |