C13H11F2NO5 — CID 90081156
ethyl N-[5-(3,4-difluorophenyl)-3,4-dihydroxyfuran-2-yl]carbamate (PubChem CID 90081156) has the molecular formula C13H11F2NO5 and a molecular weight of 299.23 g/mol. Its IUPAC name is ethyl N-[5-(3,4-difluorophenyl)-3,4-dihydroxyfuran-2-yl]carbamate.
| Compound Name | ethyl N-[5-(3,4-difluorophenyl)-3,4-dihydroxyfuran-2-yl]carbamate |
|---|---|
| PubChem CID | 90081156 |
| Molecular Formula | C13H11F2NO5 |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | ethyl N-[5-(3,4-difluorophenyl)-3,4-dihydroxyfuran-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1oc(-c2ccc(F)c(F)c2)c(O)c1O |
| InChI | InChI=1S/C13H11F2NO5/c1-2-20-13(19)16-12-10(18)9(17)11(21-12)6-3-4-7(14)8(15)5-6/h3-5,17-18H,2H2,1H3,(H,16,19) |
| InChIKey | VUYVMMLXJQPDFT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |