C13H13NO7 — CID 90081391
[2-(ethoxycarbonylamino)-5-(furan-2-yl)-4-hydroxyfuran-3-yl] acetate (PubChem CID 90081391) has the molecular formula C13H13NO7 and a molecular weight of 295.25 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-5-(furan-2-yl)-4-hydroxyfuran-3-yl] acetate.
| Compound Name | [2-(ethoxycarbonylamino)-5-(furan-2-yl)-4-hydroxyfuran-3-yl] acetate |
|---|---|
| PubChem CID | 90081391 |
| Molecular Formula | C13H13NO7 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | [2-(ethoxycarbonylamino)-5-(furan-2-yl)-4-hydroxyfuran-3-yl] acetate |
| SMILES | CCOC(=O)Nc1oc(-c2ccco2)c(O)c1OC(C)=O |
| InChI | InChI=1S/C13H13NO7/c1-3-18-13(17)14-12-11(20-7(2)15)9(16)10(21-12)8-5-4-6-19-8/h4-6,16H,3H2,1-2H3,(H,14,17) |
| InChIKey | GSQJNKCNZJBQHP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |