C18H23NO6 — CID 45119740
diethyl 2-(tert-butylamino)-5-(furan-2-yl)furan-3,4-dicarboxylate (PubChem CID 45119740) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is diethyl 2-(tert-butylamino)-5-(furan-2-yl)furan-3,4-dicarboxylate.
| Compound Name | diethyl 2-(tert-butylamino)-5-(furan-2-yl)furan-3,4-dicarboxylate |
|---|---|
| PubChem CID | 45119740 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | diethyl 2-(tert-butylamino)-5-(furan-2-yl)furan-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(NC(C)(C)C)oc(-c2ccco2)c1C(=O)OCC |
| InChI | InChI=1S/C18H23NO6/c1-6-22-16(20)12-13(17(21)23-7-2)15(19-18(3,4)5)25-14(12)11-9-8-10-24-11/h8-10,19H,6-7H2,1-5H3 |
| InChIKey | FRGQCVCHVZICME-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 90.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |