C18H14Br2O5S2 — CID 44556916
diethyl 2,5-bis(5-bromothiophen-2-yl)furan-3,4-dicarboxylate (PubChem CID 44556916) has the molecular formula C18H14Br2O5S2 and a molecular weight of 534.25 g/mol. Its IUPAC name is diethyl 2,5-bis(5-bromothiophen-2-yl)furan-3,4-dicarboxylate.
| Compound Name | diethyl 2,5-bis(5-bromothiophen-2-yl)furan-3,4-dicarboxylate |
|---|---|
| PubChem CID | 44556916 |
| Molecular Formula | C18H14Br2O5S2 |
| Molecular Weight | 534.25 g/mol |
| Exact Mass | 531.86 |
| IUPAC Name | diethyl 2,5-bis(5-bromothiophen-2-yl)furan-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Br)s2)oc(-c2ccc(Br)s2)c1C(=O)OCC |
| InChI | InChI=1S/C18H14Br2O5S2/c1-3-23-17(21)13-14(18(22)24-4-2)16(10-6-8-12(20)27-10)25-15(13)9-5-7-11(19)26-9/h5-8H,3-4H2,1-2H3 |
| InChIKey | TYOUUJKCRFUTMI-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.25 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |