diethyl 2,5-bis(5-bromothiophen-2-yl)furan-3,4-dicarboxylate

C18H14Br2O5S2 — CID 44556916

IUPACdiethyl 2,5-bis(5-bromothiophen-2-yl)furan-3,4-dicarboxylate
SMILESCCOC(=O)c1c(-c2ccc(Br)s2)oc(-c2ccc(Br)s2)c1C(=O)OCC
InChIInChI=1S/C18H14Br2O5S2/c1-3-23-17(21)13-14(18(22)24-4-2)16(10-6-8-12(20)27-10)25-15(13)9-5-7-11(19)26-9/h5-8H,3-4H2,1-2H3
InChIKeyTYOUUJKCRFUTMI-UHFFFAOYSA-N
MW534.25 g/mol
LogP6.61
Rot. Bonds6

About diethyl 2,5-bis(5-bromothiophen-2-yl)furan-3,4-dicarboxylate

diethyl 2,5-bis(5-bromothiophen-2-yl)furan-3,4-dicarboxylate (PubChem CID 44556916) has the molecular formula C18H14Br2O5S2 and a molecular weight of 534.25 g/mol. Its IUPAC name is diethyl 2,5-bis(5-bromothiophen-2-yl)furan-3,4-dicarboxylate.

Molecular Properties

Compound Namediethyl 2,5-bis(5-bromothiophen-2-yl)furan-3,4-dicarboxylate
PubChem CID44556916
Molecular FormulaC18H14Br2O5S2
Molecular Weight534.25 g/mol
Exact Mass531.86
IUPAC Namediethyl 2,5-bis(5-bromothiophen-2-yl)furan-3,4-dicarboxylate
SMILESCCOC(=O)c1c(-c2ccc(Br)s2)oc(-c2ccc(Br)s2)c1C(=O)OCC
InChIInChI=1S/C18H14Br2O5S2/c1-3-23-17(21)13-14(18(22)24-4-2)16(10-6-8-12(20)27-10)25-15(13)9-5-7-11(19)26-9/h5-8H,3-4H2,1-2H3
InChIKeyTYOUUJKCRFUTMI-UHFFFAOYSA-N
XLogP6.61
TPSA65.74 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds6
Heavy Atoms27
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500534.25
LogP ≤ 56.61
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Analyze diethyl 2,5-bis(5-bromothiophen-2-yl)furan-3,4-dicarboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of diethyl 2,5-bis(5-bromothiophen-2-yl)furan-3,4-dicarboxylate?
The IUPAC name of diethyl 2,5-bis(5-bromothiophen-2-yl)furan-3,4-dicarboxylate (CID 44556916) is diethyl 2,5-bis(5-bromothiophen-2-yl)furan-3,4-dicarboxylate.
What is the SMILES notation for diethyl 2,5-bis(5-bromothiophen-2-yl)furan-3,4-dicarboxylate?
The canonical SMILES for diethyl 2,5-bis(5-bromothiophen-2-yl)furan-3,4-dicarboxylate is CCOC(=O)c1c(-c2ccc(Br)s2)oc(-c2ccc(Br)s2)c1C(=O)OCC.
What is the InChIKey of diethyl 2,5-bis(5-bromothiophen-2-yl)furan-3,4-dicarboxylate?
The InChIKey is TYOUUJKCRFUTMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14Br2O5S2/c1-3-23-17(21)13-14(18(22)24-4-2)16(10-6-8-12(20)27-10)25-15(13)9-5-7-11(19)26-9/h5-8H,3-4H2,1-2H3.
What are the key properties of diethyl 2,5-bis(5-bromothiophen-2-yl)furan-3,4-dicarboxylate?
diethyl 2,5-bis(5-bromothiophen-2-yl)furan-3,4-dicarboxylate has a molecular weight of 534.25 g/mol, XLogP of 6.61, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2,5-bis(5-bromothiophen-2-yl)furan-3,4-dicarboxylate is sourced from PubChem (CID 44556916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).