C15H14BrNO4S2 — CID 2971519
ethyl 5-acetyl-2-[(5-bromothiophene-2-carbonyl)amino]-4-methylthiophene-3-carboxylate (PubChem CID 2971519) has the molecular formula C15H14BrNO4S2 and a molecular weight of 416.32 g/mol. Its IUPAC name is ethyl 5-acetyl-2-[(5-bromothiophene-2-carbonyl)amino]-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 5-acetyl-2-[(5-bromothiophene-2-carbonyl)amino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2971519 |
| Molecular Formula | C15H14BrNO4S2 |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 414.95 |
| IUPAC Name | ethyl 5-acetyl-2-[(5-bromothiophene-2-carbonyl)amino]-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccc(Br)s2)sc(C(C)=O)c1C |
| InChI | InChI=1S/C15H14BrNO4S2/c1-4-21-15(20)11-7(2)12(8(3)18)23-14(11)17-13(19)9-5-6-10(16)22-9/h5-6H,4H2,1-3H3,(H,17,19) |
| InChIKey | WXFQNUIKMIAPHY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |