C17H15ClFNO4S — CID 6465136
ethyl 5-acetyl-2-[(2-chloro-4-fluorobenzoyl)amino]-4-methylthiophene-3-carboxylate (PubChem CID 6465136) has the molecular formula C17H15ClFNO4S and a molecular weight of 383.83 g/mol. Its IUPAC name is ethyl 5-acetyl-2-[(2-chloro-4-fluorobenzoyl)amino]-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 5-acetyl-2-[(2-chloro-4-fluorobenzoyl)amino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 6465136 |
| Molecular Formula | C17H15ClFNO4S |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | ethyl 5-acetyl-2-[(2-chloro-4-fluorobenzoyl)amino]-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccc(F)cc2Cl)sc(C(C)=O)c1C |
| InChI | InChI=1S/C17H15ClFNO4S/c1-4-24-17(23)13-8(2)14(9(3)21)25-16(13)20-15(22)11-6-5-10(19)7-12(11)18/h5-7H,4H2,1-3H3,(H,20,22) |
| InChIKey | PRGRWIKWISQBOS-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |