C14H15NO6 — CID 90081283
ethyl N-[3,4-dihydroxy-5-(3-methoxyphenyl)furan-2-yl]carbamate (PubChem CID 90081283) has the molecular formula C14H15NO6 and a molecular weight of 293.28 g/mol. Its IUPAC name is ethyl N-[3,4-dihydroxy-5-(3-methoxyphenyl)furan-2-yl]carbamate.
| Compound Name | ethyl N-[3,4-dihydroxy-5-(3-methoxyphenyl)furan-2-yl]carbamate |
|---|---|
| PubChem CID | 90081283 |
| Molecular Formula | C14H15NO6 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | ethyl N-[3,4-dihydroxy-5-(3-methoxyphenyl)furan-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1oc(-c2cccc(OC)c2)c(O)c1O |
| InChI | InChI=1S/C14H15NO6/c1-3-20-14(18)15-13-11(17)10(16)12(21-13)8-5-4-6-9(7-8)19-2/h4-7,16-17H,3H2,1-2H3,(H,15,18) |
| InChIKey | ZVKRFEDUKZLUFN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |