About 2-amino-5-(3,4-difluorophenyl)furan-3,4-diol
2-amino-5-(3,4-difluorophenyl)furan-3,4-diol (PubChem CID 123422097) has the molecular formula C10H7F2NO3
and a molecular weight of 227.17 g/mol. Its IUPAC name is 2-amino-5-(3,4-difluorophenyl)furan-3,4-diol.
Molecular Properties
| Compound Name | 2-amino-5-(3,4-difluorophenyl)furan-3,4-diol |
| PubChem CID | 123422097 |
| Molecular Formula | C10H7F2NO3 |
| Molecular Weight | 227.17 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 2-amino-5-(3,4-difluorophenyl)furan-3,4-diol |
| SMILES | Nc1oc(-c2ccc(F)c(F)c2)c(O)c1O |
| InChI | InChI=1S/C10H7F2NO3/c11-5-2-1-4(3-6(5)12)9-7(14)8(15)10(13)16-9/h1-3,14-15H,13H2 |
| InChIKey | ILVYCLIJTRLFRD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.17 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-5-(3,4-difluorophenyl)furan-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-(3,4-difluorophenyl)furan-3,4-diol?
The IUPAC name of 2-amino-5-(3,4-difluorophenyl)furan-3,4-diol (CID 123422097) is 2-amino-5-(3,4-difluorophenyl)furan-3,4-diol.
What is the SMILES notation for 2-amino-5-(3,4-difluorophenyl)furan-3,4-diol?
The canonical SMILES for 2-amino-5-(3,4-difluorophenyl)furan-3,4-diol is Nc1oc(-c2ccc(F)c(F)c2)c(O)c1O.
What is the InChIKey of 2-amino-5-(3,4-difluorophenyl)furan-3,4-diol?
The InChIKey is ILVYCLIJTRLFRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F2NO3/c11-5-2-1-4(3-6(5)12)9-7(14)8(15)10(13)16-9/h1-3,14-15H,13H2.
What are the key properties of 2-amino-5-(3,4-difluorophenyl)furan-3,4-diol?
2-amino-5-(3,4-difluorophenyl)furan-3,4-diol has a molecular weight of 227.17 g/mol, XLogP of 2.22, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-(3,4-difluorophenyl)furan-3,4-diol is sourced from PubChem (CID 123422097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).