C10H8FNO3 — CID 123953232
2-amino-5-(2-fluorophenyl)furan-3,4-diol (PubChem CID 123953232) has the molecular formula C10H8FNO3 and a molecular weight of 209.18 g/mol. Its IUPAC name is 2-amino-5-(2-fluorophenyl)furan-3,4-diol.
| Compound Name | 2-amino-5-(2-fluorophenyl)furan-3,4-diol |
|---|---|
| PubChem CID | 123953232 |
| Molecular Formula | C10H8FNO3 |
| Molecular Weight | 209.18 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 2-amino-5-(2-fluorophenyl)furan-3,4-diol |
| SMILES | Nc1oc(-c2ccccc2F)c(O)c1O |
| InChI | InChI=1S/C10H8FNO3/c11-6-4-2-1-3-5(6)9-7(13)8(14)10(12)15-9/h1-4,13-14H,12H2 |
| InChIKey | ZMERDOPXYQODHC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.18 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |