C10H7F2NO3 — CID 123999689
2-amino-5-(2,3-difluorophenyl)furan-3,4-diol (PubChem CID 123999689) has the molecular formula C10H7F2NO3 and a molecular weight of 227.17 g/mol. Its IUPAC name is 2-amino-5-(2,3-difluorophenyl)furan-3,4-diol.
| Compound Name | 2-amino-5-(2,3-difluorophenyl)furan-3,4-diol |
|---|---|
| PubChem CID | 123999689 |
| Molecular Formula | C10H7F2NO3 |
| Molecular Weight | 227.17 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 2-amino-5-(2,3-difluorophenyl)furan-3,4-diol |
| SMILES | Nc1oc(-c2cccc(F)c2F)c(O)c1O |
| InChI | InChI=1S/C10H7F2NO3/c11-5-3-1-2-4(6(5)12)9-7(14)8(15)10(13)16-9/h1-3,14-15H,13H2 |
| InChIKey | VSAHMLIJOOSGFF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.17 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |