C15H15BrClNO6S — CID 90081630
3-acetyloxy-2-[1-bromo-3-(sulfinoamino)propyl]-5-(4-chlorophenyl)-4-hydroxyfuran (PubChem CID 90081630) has the molecular formula C15H15BrClNO6S and a molecular weight of 452.71 g/mol. Its IUPAC name is 3-acetyloxy-2-[1-bromo-3-(sulfinoamino)propyl]-5-(4-chlorophenyl)-4-hydroxyfuran.
| Compound Name | 3-acetyloxy-2-[1-bromo-3-(sulfinoamino)propyl]-5-(4-chlorophenyl)-4-hydroxyfuran |
|---|---|
| PubChem CID | 90081630 |
| Molecular Formula | C15H15BrClNO6S |
| Molecular Weight | 452.71 g/mol |
| Exact Mass | 450.95 |
| IUPAC Name | 3-acetyloxy-2-[1-bromo-3-(sulfinoamino)propyl]-5-(4-chlorophenyl)-4-hydroxyfuran |
| SMILES | CC(=O)Oc1c(C(Br)CCNS(=O)O)oc(-c2ccc(Cl)cc2)c1O |
| InChI | InChI=1S/C15H15BrClNO6S/c1-8(19)23-15-12(20)13(9-2-4-10(17)5-3-9)24-14(15)11(16)6-7-18-25(21)22/h2-5,11,18,20H,6-7H2,1H3,(H,21,22) |
| InChIKey | JGPJRDXZMIKONB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.71 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|