C15H14BrCl2NO6S — CID 90081149
3-acetyloxy-2-[1-bromo-3-(sulfinoamino)propyl]-5-(2,5-dichlorophenyl)-4-hydroxyfuran (PubChem CID 90081149) has the molecular formula C15H14BrCl2NO6S and a molecular weight of 487.16 g/mol. Its IUPAC name is 3-acetyloxy-2-[1-bromo-3-(sulfinoamino)propyl]-5-(2,5-dichlorophenyl)-4-hydroxyfuran.
| Compound Name | 3-acetyloxy-2-[1-bromo-3-(sulfinoamino)propyl]-5-(2,5-dichlorophenyl)-4-hydroxyfuran |
|---|---|
| PubChem CID | 90081149 |
| Molecular Formula | C15H14BrCl2NO6S |
| Molecular Weight | 487.16 g/mol |
| Exact Mass | 484.91 |
| IUPAC Name | 3-acetyloxy-2-[1-bromo-3-(sulfinoamino)propyl]-5-(2,5-dichlorophenyl)-4-hydroxyfuran |
| SMILES | CC(=O)Oc1c(C(Br)CCNS(=O)O)oc(-c2cc(Cl)ccc2Cl)c1O |
| InChI | InChI=1S/C15H14BrCl2NO6S/c1-7(20)24-15-12(21)13(9-6-8(17)2-3-11(9)18)25-14(15)10(16)4-5-19-26(22)23/h2-3,6,10,19,21H,4-5H2,1H3,(H,22,23) |
| InChIKey | DMGSJUPKXAPLOP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.16 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|