C16H11Cl2NO6 — CID 90081056
[5-(2,4-dichlorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxyfuran-3-yl] acetate (PubChem CID 90081056) has the molecular formula C16H11Cl2NO6 and a molecular weight of 384.17 g/mol. Its IUPAC name is [5-(2,4-dichlorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxyfuran-3-yl] acetate.
| Compound Name | [5-(2,4-dichlorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxyfuran-3-yl] acetate |
|---|---|
| PubChem CID | 90081056 |
| Molecular Formula | C16H11Cl2NO6 |
| Molecular Weight | 384.17 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | [5-(2,4-dichlorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxyfuran-3-yl] acetate |
| SMILES | CC(=O)Oc1c(N2C(=O)CCC2=O)oc(-c2ccc(Cl)cc2Cl)c1O |
| InChI | InChI=1S/C16H11Cl2NO6/c1-7(20)24-15-13(23)14(9-3-2-8(17)6-10(9)18)25-16(15)19-11(21)4-5-12(19)22/h2-3,6,23H,4-5H2,1H3 |
| InChIKey | VLUHUMMQEJLMNQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.17 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|