C17H20BrNO8S — CID 90081373
3-acetyloxy-2-[1-bromo-3-(sulfinoamino)propyl]-5-(2,4-dimethoxyphenyl)-4-hydroxyfuran (PubChem CID 90081373) has the molecular formula C17H20BrNO8S and a molecular weight of 478.32 g/mol. Its IUPAC name is 3-acetyloxy-2-[1-bromo-3-(sulfinoamino)propyl]-5-(2,4-dimethoxyphenyl)-4-hydroxyfuran.
| Compound Name | 3-acetyloxy-2-[1-bromo-3-(sulfinoamino)propyl]-5-(2,4-dimethoxyphenyl)-4-hydroxyfuran |
|---|---|
| PubChem CID | 90081373 |
| Molecular Formula | C17H20BrNO8S |
| Molecular Weight | 478.32 g/mol |
| Exact Mass | 477.01 |
| IUPAC Name | 3-acetyloxy-2-[1-bromo-3-(sulfinoamino)propyl]-5-(2,4-dimethoxyphenyl)-4-hydroxyfuran |
| SMILES | COc1ccc(-c2oc(C(Br)CCNS(=O)O)c(OC(C)=O)c2O)c(OC)c1 |
| InChI | InChI=1S/C17H20BrNO8S/c1-9(20)26-17-14(21)15(11-5-4-10(24-2)8-13(11)25-3)27-16(17)12(18)6-7-19-28(22)23/h4-5,8,12,19,21H,6-7H2,1-3H3,(H,22,23) |
| InChIKey | GTUUQNSNKFGBJH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 127.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|