C16H19BrCl2NO5SSi- — CID 90080598
2-[1-bromo-3-(sulfinatoamino)propyl]-5-(3,4-dichlorophenyl)-4-hydroxy-3-trimethylsilyloxyfuran (PubChem CID 90080598) has the molecular formula C16H19BrCl2NO5SSi- and a molecular weight of 516.29 g/mol. Its IUPAC name is 2-[1-bromo-3-(sulfinatoamino)propyl]-5-(3,4-dichlorophenyl)-4-hydroxy-3-trimethylsilyloxyfuran.
| Compound Name | 2-[1-bromo-3-(sulfinatoamino)propyl]-5-(3,4-dichlorophenyl)-4-hydroxy-3-trimethylsilyloxyfuran |
|---|---|
| PubChem CID | 90080598 |
| Molecular Formula | C16H19BrCl2NO5SSi- |
| Molecular Weight | 516.29 g/mol |
| Exact Mass | 513.93 |
| IUPAC Name | 2-[1-bromo-3-(sulfinatoamino)propyl]-5-(3,4-dichlorophenyl)-4-hydroxy-3-trimethylsilyloxyfuran |
| SMILES | C[Si](C)(C)Oc1c(C(Br)CCNS(=O)[O-])oc(-c2ccc(Cl)c(Cl)c2)c1O |
| InChI | InChI=1S/C16H20BrCl2NO5SSi/c1-27(2,3)25-16-13(21)14(9-4-5-11(18)12(19)8-9)24-15(16)10(17)6-7-20-26(22)23/h4-5,8,10,20-21H,6-7H2,1-3H3,(H,22,23)/p-1 |
| InChIKey | DUPZPZQQKKVLAC-UHFFFAOYSA-M |
| XLogP | 5.38 |
| TPSA | 94.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.29 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|