C12H9F2NO4 — CID 90081502
N-[5-(2,6-difluorophenyl)-3,4-dihydroxyfuran-2-yl]acetamide (PubChem CID 90081502) has the molecular formula C12H9F2NO4 and a molecular weight of 269.20 g/mol. Its IUPAC name is N-[5-(2,6-difluorophenyl)-3,4-dihydroxyfuran-2-yl]acetamide.
| Compound Name | N-[5-(2,6-difluorophenyl)-3,4-dihydroxyfuran-2-yl]acetamide |
|---|---|
| PubChem CID | 90081502 |
| Molecular Formula | C12H9F2NO4 |
| Molecular Weight | 269.20 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | N-[5-(2,6-difluorophenyl)-3,4-dihydroxyfuran-2-yl]acetamide |
| SMILES | CC(=O)Nc1oc(-c2c(F)cccc2F)c(O)c1O |
| InChI | InChI=1S/C12H9F2NO4/c1-5(16)15-12-10(18)9(17)11(19-12)8-6(13)3-2-4-7(8)14/h2-4,17-18H,1H3,(H,15,16) |
| InChIKey | KMYHYYPMCLBWSD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |