C17H15NO6S — CID 90080934
[4-hydroxy-2-(methanesulfonamido)-5-naphthalen-1-ylfuran-3-yl] acetate (PubChem CID 90080934) has the molecular formula C17H15NO6S and a molecular weight of 361.38 g/mol. Its IUPAC name is [4-hydroxy-2-(methanesulfonamido)-5-naphthalen-1-ylfuran-3-yl] acetate.
| Compound Name | [4-hydroxy-2-(methanesulfonamido)-5-naphthalen-1-ylfuran-3-yl] acetate |
|---|---|
| PubChem CID | 90080934 |
| Molecular Formula | C17H15NO6S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | [4-hydroxy-2-(methanesulfonamido)-5-naphthalen-1-ylfuran-3-yl] acetate |
| SMILES | CC(=O)Oc1c(NS(C)(=O)=O)oc(-c2cccc3ccccc23)c1O |
| InChI | InChI=1S/C17H15NO6S/c1-10(19)23-16-14(20)15(24-17(16)18-25(2,21)22)13-9-5-7-11-6-3-4-8-12(11)13/h3-9,18,20H,1-2H3 |
| InChIKey | UVRKAMNPYSHNIR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |