C18H13ClFNO6S — CID 90081582
[2-(benzenesulfonamido)-5-(3-chloro-2-fluorophenyl)-4-hydroxyfuran-3-yl] acetate (PubChem CID 90081582) has the molecular formula C18H13ClFNO6S and a molecular weight of 425.82 g/mol. Its IUPAC name is [2-(benzenesulfonamido)-5-(3-chloro-2-fluorophenyl)-4-hydroxyfuran-3-yl] acetate.
| Compound Name | [2-(benzenesulfonamido)-5-(3-chloro-2-fluorophenyl)-4-hydroxyfuran-3-yl] acetate |
|---|---|
| PubChem CID | 90081582 |
| Molecular Formula | C18H13ClFNO6S |
| Molecular Weight | 425.82 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | [2-(benzenesulfonamido)-5-(3-chloro-2-fluorophenyl)-4-hydroxyfuran-3-yl] acetate |
| SMILES | CC(=O)Oc1c(NS(=O)(=O)c2ccccc2)oc(-c2cccc(Cl)c2F)c1O |
| InChI | InChI=1S/C18H13ClFNO6S/c1-10(22)26-17-15(23)16(12-8-5-9-13(19)14(12)20)27-18(17)21-28(24,25)11-6-3-2-4-7-11/h2-9,21,23H,1H3 |
| InChIKey | VFOFQRPGIKWYRS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.82 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |