C19H14N2O5S — CID 136631431
N-(3,4-dihydroxy-5-quinolin-4-ylfuran-2-yl)benzenesulfonamide (PubChem CID 136631431) has the molecular formula C19H14N2O5S and a molecular weight of 382.40 g/mol. Its IUPAC name is N-(3,4-dihydroxy-5-quinolin-4-ylfuran-2-yl)benzenesulfonamide.
| Compound Name | N-(3,4-dihydroxy-5-quinolin-4-ylfuran-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 136631431 |
| Molecular Formula | C19H14N2O5S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | N-(3,4-dihydroxy-5-quinolin-4-ylfuran-2-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1oc(-c2ccnc3ccccc23)c(O)c1O)c1ccccc1 |
| InChI | InChI=1S/C19H14N2O5S/c22-16-17(23)19(21-27(24,25)12-6-2-1-3-7-12)26-18(16)14-10-11-20-15-9-5-4-8-13(14)15/h1-11,21-23H |
| InChIKey | NTSPOEJYQIFGRN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |