About N-(3,4-dihydroxy-5-quinolin-4-ylfuran-2-yl)benzenesulfonamide
N-(3,4-dihydroxy-5-quinolin-4-ylfuran-2-yl)benzenesulfonamide (PubChem CID 136631431) has the molecular formula C19H14N2O5S
and a molecular weight of 382.40 g/mol. Its IUPAC name is N-(3,4-dihydroxy-5-quinolin-4-ylfuran-2-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-(3,4-dihydroxy-5-quinolin-4-ylfuran-2-yl)benzenesulfonamide |
| PubChem CID | 136631431 |
| Molecular Formula | C19H14N2O5S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | N-(3,4-dihydroxy-5-quinolin-4-ylfuran-2-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1oc(-c2ccnc3ccccc23)c(O)c1O)c1ccccc1 |
| InChI | InChI=1S/C19H14N2O5S/c22-16-17(23)19(21-27(24,25)12-6-2-1-3-7-12)26-18(16)14-10-11-20-15-9-5-4-8-13(14)15/h1-11,21-23H |
| InChIKey | NTSPOEJYQIFGRN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(3,4-dihydroxy-5-quinolin-4-ylfuran-2-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dihydroxy-5-quinolin-4-ylfuran-2-yl)benzenesulfonamide?
The IUPAC name of N-(3,4-dihydroxy-5-quinolin-4-ylfuran-2-yl)benzenesulfonamide (CID 136631431) is N-(3,4-dihydroxy-5-quinolin-4-ylfuran-2-yl)benzenesulfonamide.
What is the SMILES notation for N-(3,4-dihydroxy-5-quinolin-4-ylfuran-2-yl)benzenesulfonamide?
The canonical SMILES for N-(3,4-dihydroxy-5-quinolin-4-ylfuran-2-yl)benzenesulfonamide is O=S(=O)(Nc1oc(-c2ccnc3ccccc23)c(O)c1O)c1ccccc1.
What is the InChIKey of N-(3,4-dihydroxy-5-quinolin-4-ylfuran-2-yl)benzenesulfonamide?
The InChIKey is NTSPOEJYQIFGRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N2O5S/c22-16-17(23)19(21-27(24,25)12-6-2-1-3-7-12)26-18(16)14-10-11-20-15-9-5-4-8-13(14)15/h1-11,21-23H.
What are the key properties of N-(3,4-dihydroxy-5-quinolin-4-ylfuran-2-yl)benzenesulfonamide?
N-(3,4-dihydroxy-5-quinolin-4-ylfuran-2-yl)benzenesulfonamide has a molecular weight of 382.40 g/mol, XLogP of 3.71, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dihydroxy-5-quinolin-4-ylfuran-2-yl)benzenesulfonamide is sourced from PubChem (CID 136631431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).