C20H21N3O4S — CID 16854243
N-[5-(2,5-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-4-phenylsulfanylbutanamide (PubChem CID 16854243) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is N-[5-(2,5-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-4-phenylsulfanylbutanamide.
| Compound Name | N-[5-(2,5-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-4-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 16854243 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-[5-(2,5-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-4-phenylsulfanylbutanamide |
| SMILES | COc1ccc(OC)c(-c2nnc(NC(=O)CCCSc3ccccc3)o2)c1 |
| InChI | InChI=1S/C20H21N3O4S/c1-25-14-10-11-17(26-2)16(13-14)19-22-23-20(27-19)21-18(24)9-6-12-28-15-7-4-3-5-8-15/h3-5,7-8,10-11,13H,6,9,12H2,1-2H3,(H,21,23,24) |
| InChIKey | YCTGORLRJHBXSN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|