C18H15Cl2N3O2S — CID 43976527
N-[5-(3,5-dichlorophenyl)-1,3,4-oxadiazol-2-yl]-4-phenylsulfanylbutanamide (PubChem CID 43976527) has the molecular formula C18H15Cl2N3O2S and a molecular weight of 408.31 g/mol. Its IUPAC name is N-[5-(3,5-dichlorophenyl)-1,3,4-oxadiazol-2-yl]-4-phenylsulfanylbutanamide.
| Compound Name | N-[5-(3,5-dichlorophenyl)-1,3,4-oxadiazol-2-yl]-4-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 43976527 |
| Molecular Formula | C18H15Cl2N3O2S |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | N-[5-(3,5-dichlorophenyl)-1,3,4-oxadiazol-2-yl]-4-phenylsulfanylbutanamide |
| SMILES | O=C(CCCSc1ccccc1)Nc1nnc(-c2cc(Cl)cc(Cl)c2)o1 |
| InChI | InChI=1S/C18H15Cl2N3O2S/c19-13-9-12(10-14(20)11-13)17-22-23-18(25-17)21-16(24)7-4-8-26-15-5-2-1-3-6-15/h1-3,5-6,9-11H,4,7-8H2,(H,21,23,24) |
| InChIKey | HZVPFTRVFUMHNQ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|