C20H20FN3O4S — CID 41271839
N-[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-4-(4-fluorophenyl)sulfanylbutanamide (PubChem CID 41271839) has the molecular formula C20H20FN3O4S and a molecular weight of 417.46 g/mol. Its IUPAC name is N-[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-4-(4-fluorophenyl)sulfanylbutanamide.
| Compound Name | N-[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-4-(4-fluorophenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 41271839 |
| Molecular Formula | C20H20FN3O4S |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | N-[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-4-(4-fluorophenyl)sulfanylbutanamide |
| SMILES | COc1ccc(-c2nnc(NC(=O)CCCSc3ccc(F)cc3)o2)c(OC)c1 |
| InChI | InChI=1S/C20H20FN3O4S/c1-26-14-7-10-16(17(12-14)27-2)19-23-24-20(28-19)22-18(25)4-3-11-29-15-8-5-13(21)6-9-15/h5-10,12H,3-4,11H2,1-2H3,(H,22,24,25) |
| InChIKey | HKLXFVWLCBDPNO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|