C14H15N3O5S — CID 16949205
S-[2-[[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]amino]-2-oxoethyl] ethanethioate (PubChem CID 16949205) has the molecular formula C14H15N3O5S and a molecular weight of 337.36 g/mol. Its IUPAC name is S-[2-[[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]amino]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]amino]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 16949205 |
| Molecular Formula | C14H15N3O5S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | S-[2-[[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]amino]-2-oxoethyl] ethanethioate |
| SMILES | COc1ccc(-c2nnc(NC(=O)CSC(C)=O)o2)c(OC)c1 |
| InChI | InChI=1S/C14H15N3O5S/c1-8(18)23-7-12(19)15-14-17-16-13(22-14)10-5-4-9(20-2)6-11(10)21-3/h4-6H,7H2,1-3H3,(H,15,17,19) |
| InChIKey | ZPEHJYJSYQEKCL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|