C16H12Cl2FN3O2S2 — CID 43973027
N-[5-(2,5-dichlorothiophen-3-yl)-1,3,4-oxadiazol-2-yl]-4-(4-fluorophenyl)sulfanylbutanamide (PubChem CID 43973027) has the molecular formula C16H12Cl2FN3O2S2 and a molecular weight of 432.33 g/mol. Its IUPAC name is N-[5-(2,5-dichlorothiophen-3-yl)-1,3,4-oxadiazol-2-yl]-4-(4-fluorophenyl)sulfanylbutanamide.
| Compound Name | N-[5-(2,5-dichlorothiophen-3-yl)-1,3,4-oxadiazol-2-yl]-4-(4-fluorophenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 43973027 |
| Molecular Formula | C16H12Cl2FN3O2S2 |
| Molecular Weight | 432.33 g/mol |
| Exact Mass | 430.97 |
| IUPAC Name | N-[5-(2,5-dichlorothiophen-3-yl)-1,3,4-oxadiazol-2-yl]-4-(4-fluorophenyl)sulfanylbutanamide |
| SMILES | O=C(CCCSc1ccc(F)cc1)Nc1nnc(-c2cc(Cl)sc2Cl)o1 |
| InChI | InChI=1S/C16H12Cl2FN3O2S2/c17-12-8-11(14(18)26-12)15-21-22-16(24-15)20-13(23)2-1-7-25-10-5-3-9(19)4-6-10/h3-6,8H,1-2,7H2,(H,20,22,23) |
| InChIKey | QTVDUYVUUWZJQM-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.33 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|