C16H21BrClNO5SSi — CID 90081146
3-bromo-N-[5-(3-chlorophenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]propane-1-sulfonamide (PubChem CID 90081146) has the molecular formula C16H21BrClNO5SSi and a molecular weight of 482.86 g/mol. Its IUPAC name is 3-bromo-N-[5-(3-chlorophenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]propane-1-sulfonamide.
| Compound Name | 3-bromo-N-[5-(3-chlorophenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 90081146 |
| Molecular Formula | C16H21BrClNO5SSi |
| Molecular Weight | 482.86 g/mol |
| Exact Mass | 480.98 |
| IUPAC Name | 3-bromo-N-[5-(3-chlorophenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]propane-1-sulfonamide |
| SMILES | C[Si](C)(C)Oc1c(NS(=O)(=O)CCCBr)oc(-c2cccc(Cl)c2)c1O |
| InChI | InChI=1S/C16H21BrClNO5SSi/c1-26(2,3)24-15-13(20)14(11-6-4-7-12(18)10-11)23-16(15)19-25(21,22)9-5-8-17/h4,6-7,10,19-20H,5,8-9H2,1-3H3 |
| InChIKey | ABHBTGPJLSNHCM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.86 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|