C16H16N2O5 — CID 140834002
[5-methyl-4-oxo-2-(2-oxopyrrolidin-1-yl)-5-pyridin-4-ylfuran-3-yl] acetate (PubChem CID 140834002) has the molecular formula C16H16N2O5 and a molecular weight of 316.31 g/mol. Its IUPAC name is [5-methyl-4-oxo-2-(2-oxopyrrolidin-1-yl)-5-pyridin-4-ylfuran-3-yl] acetate.
| Compound Name | [5-methyl-4-oxo-2-(2-oxopyrrolidin-1-yl)-5-pyridin-4-ylfuran-3-yl] acetate |
|---|---|
| PubChem CID | 140834002 |
| Molecular Formula | C16H16N2O5 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | [5-methyl-4-oxo-2-(2-oxopyrrolidin-1-yl)-5-pyridin-4-ylfuran-3-yl] acetate |
| SMILES | CC(=O)OC1=C(N2CCCC2=O)OC(C)(c2ccncc2)C1=O |
| InChI | InChI=1S/C16H16N2O5/c1-10(19)22-13-14(21)16(2,11-5-7-17-8-6-11)23-15(13)18-9-3-4-12(18)20/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | KHCGHMOYAUCVFQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |