C12H14O2S — CID 101431520
(2S,3S)-2-methyl-2-thiophen-2-yl-4-oxaspiro[2.5]octan-5-one (PubChem CID 101431520) has the molecular formula C12H14O2S and a molecular weight of 222.31 g/mol. Its IUPAC name is (2S,3S)-2-methyl-2-thiophen-2-yl-4-oxaspiro[2.5]octan-5-one.
| Compound Name | (2S,3S)-2-methyl-2-thiophen-2-yl-4-oxaspiro[2.5]octan-5-one |
|---|---|
| PubChem CID | 101431520 |
| Molecular Formula | C12H14O2S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | (2S,3S)-2-methyl-2-thiophen-2-yl-4-oxaspiro[2.5]octan-5-one |
| SMILES | C[C@]1(c2cccs2)C[C@@]12CCCC(=O)O2 |
| InChI | InChI=1S/C12H14O2S/c1-11(9-4-3-7-15-9)8-12(11)6-2-5-10(13)14-12/h3-4,7H,2,5-6,8H2,1H3/t11-,12+/m1/s1 |
| InChIKey | OLGVYAYUGKSWCA-NEPJUHHUSA-N |
| XLogP | 2.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |