C12H17NOS — CID 110698462
N,N-diethyl-1-thiophen-2-ylcyclopropane-1-carboxamide (PubChem CID 110698462) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is N,N-diethyl-1-thiophen-2-ylcyclopropane-1-carboxamide.
| Compound Name | N,N-diethyl-1-thiophen-2-ylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 110698462 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | N,N-diethyl-1-thiophen-2-ylcyclopropane-1-carboxamide |
| SMILES | CCN(CC)C(=O)C1(c2cccs2)CC1 |
| InChI | InChI=1S/C12H17NOS/c1-3-13(4-2)11(14)12(7-8-12)10-6-5-9-15-10/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | LIVIWUGZGOQSLJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |