C22H21NOS — CID 42435357
N,N-diphenyl-1-thiophen-2-ylcyclopentane-1-carboxamide (PubChem CID 42435357) has the molecular formula C22H21NOS and a molecular weight of 347.48 g/mol. Its IUPAC name is N,N-diphenyl-1-thiophen-2-ylcyclopentane-1-carboxamide.
| Compound Name | N,N-diphenyl-1-thiophen-2-ylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 42435357 |
| Molecular Formula | C22H21NOS |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N,N-diphenyl-1-thiophen-2-ylcyclopentane-1-carboxamide |
| SMILES | O=C(N(c1ccccc1)c1ccccc1)C1(c2cccs2)CCCC1 |
| InChI | InChI=1S/C22H21NOS/c24-21(22(15-7-8-16-22)20-14-9-17-25-20)23(18-10-3-1-4-11-18)19-12-5-2-6-13-19/h1-6,9-14,17H,7-8,15-16H2 |
| InChIKey | JSKXEMHIWHEVQY-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |