C15H19NO6S — CID 174753590
N-[3-hydroxy-5-(2-methoxyphenyl)-5-methyl-4-oxofuran-2-yl]-N-methylethanesulfonamide (PubChem CID 174753590) has the molecular formula C15H19NO6S and a molecular weight of 341.39 g/mol. Its IUPAC name is N-[3-hydroxy-5-(2-methoxyphenyl)-5-methyl-4-oxofuran-2-yl]-N-methylethanesulfonamide.
| Compound Name | N-[3-hydroxy-5-(2-methoxyphenyl)-5-methyl-4-oxofuran-2-yl]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 174753590 |
| Molecular Formula | C15H19NO6S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | N-[3-hydroxy-5-(2-methoxyphenyl)-5-methyl-4-oxofuran-2-yl]-N-methylethanesulfonamide |
| SMILES | CCS(=O)(=O)N(C)C1=C(O)C(=O)C(C)(c2ccccc2OC)O1 |
| InChI | InChI=1S/C15H19NO6S/c1-5-23(19,20)16(3)14-12(17)13(18)15(2,22-14)10-8-6-7-9-11(10)21-4/h6-9,17H,5H2,1-4H3 |
| InChIKey | LPXNJLSASKLJRR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |