C14H26O — CID 14083497
(2E)-1-butoxy-3,7-dimethylocta-2,6-diene (PubChem CID 14083497) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is (2E)-1-butoxy-3,7-dimethylocta-2,6-diene.
| Compound Name | (2E)-1-butoxy-3,7-dimethylocta-2,6-diene |
|---|---|
| PubChem CID | 14083497 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | (2E)-1-butoxy-3,7-dimethylocta-2,6-diene |
| SMILES | CCCCOC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C14H26O/c1-5-6-11-15-12-10-14(4)9-7-8-13(2)3/h8,10H,5-7,9,11-12H2,1-4H3/b14-10+ |
| InChIKey | NHCQMVNKPJAQJZ-GXDHUFHOSA-N |
| XLogP | 4.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|