C22H56O8Si5 — CID 140840489
hexyl-hydroxy-[[[[hydroxy(dimethoxy)silyl]oxy-dimethylsilyl]oxy-methoxy-methylsilyl]oxy-methyl-octylsilyl]-methylsilane (PubChem CID 140840489) has the molecular formula C22H56O8Si5 and a molecular weight of 589.11 g/mol. Its IUPAC name is hexyl-hydroxy-[[[[hydroxy(dimethoxy)silyl]oxy-dimethylsilyl]oxy-methoxy-methylsilyl]oxy-methyl-octylsilyl]-methylsilane.
| Compound Name | hexyl-hydroxy-[[[[hydroxy(dimethoxy)silyl]oxy-dimethylsilyl]oxy-methoxy-methylsilyl]oxy-methyl-octylsilyl]-methylsilane |
|---|---|
| PubChem CID | 140840489 |
| Molecular Formula | C22H56O8Si5 |
| Molecular Weight | 589.11 g/mol |
| Exact Mass | 588.28 |
| IUPAC Name | hexyl-hydroxy-[[[[hydroxy(dimethoxy)silyl]oxy-dimethylsilyl]oxy-methoxy-methylsilyl]oxy-methyl-octylsilyl]-methylsilane |
| SMILES | CCCCCCCC[Si](C)(O[Si](C)(OC)O[Si](C)(C)O[Si](O)(OC)OC)[Si](C)(O)CCCCCC |
| InChI | InChI=1S/C22H56O8Si5/c1-11-13-15-17-18-20-22-33(9,32(8,23)21-19-16-14-12-2)30-34(10,25-3)28-31(6,7)29-35(24,26-4)27-5/h23-24H,11-22H2,1-10H3 |
| InChIKey | WMGALRMESRXKSI-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.11 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|