C15H13N2S — CID 140841356
N3-Methyl-N3-phenylbenzo [b]thiophene-2,3-diamine hydrochloride (PubChem CID 140841356) has the molecular formula C15H13N2S and a molecular weight of 253.35 g/mol.
| Compound Name | N3-Methyl-N3-phenylbenzo [b]thiophene-2,3-diamine hydrochloride |
|---|---|
| PubChem CID | 140841356 |
| Molecular Formula | C15H13N2S |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | — |
| SMILES | CN(c1ccccc1)c1c([NH])sc2ccccc12 |
| InChI | InChI=1S/C15H13N2S/c1-17(11-7-3-2-4-8-11)14-12-9-5-6-10-13(12)18-15(14)16/h2-10,16H,1H3 |
| InChIKey | ABKOXDAHIXTSRO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 27.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |