C22H10F6I3O7S- — CID 140841667
3,3,3-trifluoro-2-(trifluoromethyl)-2-[8-(2,4,6-triiodophenoxy)carbonylnaphthalene-1-carbonyl]oxypropane-1-sulfonate (PubChem CID 140841667) has the molecular formula C22H10F6I3O7S- and a molecular weight of 913.08 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(trifluoromethyl)-2-[8-(2,4,6-triiodophenoxy)carbonylnaphthalene-1-carbonyl]oxypropane-1-sulfonate.
| Compound Name | 3,3,3-trifluoro-2-(trifluoromethyl)-2-[8-(2,4,6-triiodophenoxy)carbonylnaphthalene-1-carbonyl]oxypropane-1-sulfonate |
|---|---|
| PubChem CID | 140841667 |
| Molecular Formula | C22H10F6I3O7S- |
| Molecular Weight | 913.08 g/mol |
| Exact Mass | 912.72 |
| IUPAC Name | 3,3,3-trifluoro-2-(trifluoromethyl)-2-[8-(2,4,6-triiodophenoxy)carbonylnaphthalene-1-carbonyl]oxypropane-1-sulfonate |
| SMILES | O=C(Oc1c(I)cc(I)cc1I)c1cccc2cccc(C(=O)OC(CS(=O)(=O)[O-])(C(F)(F)F)C(F)(F)F)c12 |
| InChI | InChI=1S/C22H11F6I3O7S/c23-21(24,25)20(22(26,27)28,9-39(34,35)36)38-19(33)13-6-2-4-10-3-1-5-12(16(10)13)18(32)37-17-14(30)7-11(29)8-15(17)31/h1-8H,9H2,(H,34,35,36)/p-1 |
| InChIKey | BXSZFOLZOWLSNP-UHFFFAOYSA-M |
| XLogP | 6.44 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.08 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|