C12H15NO18S2-4 — CID 140843766
(2R,4S)-3,4-dihydroxy-2-[(3R,4R,6R)-6-hydroxy-4-oxidoperoxy-5-(sulfonatoamino)-2-(sulfonatooxymethyl)oxan-3-yl]oxy-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 140843766) has the molecular formula C12H15NO18S2-4 and a molecular weight of 525.38 g/mol. Its IUPAC name is (2R,4S)-3,4-dihydroxy-2-[(3R,4R,6R)-6-hydroxy-4-oxidoperoxy-5-(sulfonatoamino)-2-(sulfonatooxymethyl)oxan-3-yl]oxy-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | (2R,4S)-3,4-dihydroxy-2-[(3R,4R,6R)-6-hydroxy-4-oxidoperoxy-5-(sulfonatoamino)-2-(sulfonatooxymethyl)oxan-3-yl]oxy-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 140843766 |
| Molecular Formula | C12H15NO18S2-4 |
| Molecular Weight | 525.38 g/mol |
| Exact Mass | 524.98 |
| IUPAC Name | (2R,4S)-3,4-dihydroxy-2-[(3R,4R,6R)-6-hydroxy-4-oxidoperoxy-5-(sulfonatoamino)-2-(sulfonatooxymethyl)oxan-3-yl]oxy-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | O=C([O-])C1=C[C@H](O)C(O)[C@H](O[C@@H]2C(COS(=O)(=O)[O-])O[C@@H](O)C(NS(=O)(=O)[O-])[C@H]2OO[O-])O1 |
| InChI | InChI=1S/C12H19NO18S2/c14-3-1-4(10(16)17)28-12(7(3)15)29-8-5(2-26-33(23,24)25)27-11(18)6(9(8)30-31-19)13-32(20,21)22/h1,3,5-9,11-15,18-19H,2H2,(H,16,17)(H,20,21,22)(H,23,24,25)/p-4/t3-,5?,6?,7?,8+,9+,11+,12-/m0/s1 |
| InChIKey | GHMVNDSDMHFMNH-PCGWHIKXSA-J |
| XLogP | -7.71 |
| TPSA | 305.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.38 |
| LogP ≤ 5 | -7.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|