C12H14O12-2 — CID 146037226
(2R,3S,4S)-2-[(3S,4R,5S,6R)-2-carboxylato-4,5,6-trihydroxyoxan-3-yl]oxy-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 146037226) has the molecular formula C12H14O12-2 and a molecular weight of 350.23 g/mol. Its IUPAC name is (2R,3S,4S)-2-[(3S,4R,5S,6R)-2-carboxylato-4,5,6-trihydroxyoxan-3-yl]oxy-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | (2R,3S,4S)-2-[(3S,4R,5S,6R)-2-carboxylato-4,5,6-trihydroxyoxan-3-yl]oxy-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 146037226 |
| Molecular Formula | C12H14O12-2 |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | (2R,3S,4S)-2-[(3S,4R,5S,6R)-2-carboxylato-4,5,6-trihydroxyoxan-3-yl]oxy-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | O=C([O-])C1=C[C@H](O)[C@H](O)[C@H](O[C@@H]2C(C(=O)[O-])O[C@@H](O)[C@@H](O)[C@H]2O)O1 |
| InChI | InChI=1S/C12H16O12/c13-2-1-3(9(17)18)22-12(4(2)14)24-7-5(15)6(16)11(21)23-8(7)10(19)20/h1-2,4-8,11-16,21H,(H,17,18)(H,19,20)/p-2/t2-,4-,5+,6-,7-,8?,11+,12-/m0/s1 |
| InChIKey | LLVVMXFNKAHVEZ-SJJWUPISSA-L |
| XLogP | -6.73 |
| TPSA | 209.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | -6.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |