C62H42N4 — CID 140846666
9-[4-(2,6-diphenyl-4-pyridinyl)-5-isocyano-2-[3-(3-methylphenyl)carbazol-9-yl]phenyl]-3-(3-methylphenyl)carbazole (PubChem CID 140846666) has the molecular formula C62H42N4 and a molecular weight of 843.05 g/mol. Its IUPAC name is 9-[4-(2,6-diphenyl-4-pyridinyl)-5-isocyano-2-[3-(3-methylphenyl)carbazol-9-yl]phenyl]-3-(3-methylphenyl)carbazole.
| Compound Name | 9-[4-(2,6-diphenyl-4-pyridinyl)-5-isocyano-2-[3-(3-methylphenyl)carbazol-9-yl]phenyl]-3-(3-methylphenyl)carbazole |
|---|---|
| PubChem CID | 140846666 |
| Molecular Formula | C62H42N4 |
| Molecular Weight | 843.05 g/mol |
| Exact Mass | 842.34 |
| IUPAC Name | 9-[4-(2,6-diphenyl-4-pyridinyl)-5-isocyano-2-[3-(3-methylphenyl)carbazol-9-yl]phenyl]-3-(3-methylphenyl)carbazole |
| SMILES | [C-]#[N+]c1cc(-n2c3ccccc3c3cc(-c4cccc(C)c4)ccc32)c(-n2c3ccccc3c3cc(-c4cccc(C)c4)ccc32)cc1-c1cc(-c2ccccc2)nc(-c2ccccc2)c1 |
| InChI | InChI=1S/C62H42N4/c1-40-16-14-22-44(32-40)46-28-30-59-52(34-46)49-24-10-12-26-57(49)65(59)61-38-51(48-36-54(42-18-6-4-7-19-42)64-55(37-48)43-20-8-5-9-21-43)56(63-3)39-62(61)66-58-27-13-11-25-50(58)53-35-47(29-31-60(53)66)45-23-15-17-41(2)33-45/h4-39H,1-2H3 |
| InChIKey | ZLWSASIYZGTRQU-UHFFFAOYSA-N |
| XLogP | 16.78 |
| TPSA | 27.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.05 |
| LogP ≤ 5 | 16.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|