C66H44N6 — CID 154603036
9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[2-isocyano-6-[3-(3-methylphenyl)carbazol-9-yl]phenyl]phenyl]-3-(3-methylphenyl)carbazole (PubChem CID 154603036) has the molecular formula C66H44N6 and a molecular weight of 921.12 g/mol. Its IUPAC name is 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[2-isocyano-6-[3-(3-methylphenyl)carbazol-9-yl]phenyl]phenyl]-3-(3-methylphenyl)carbazole.
| Compound Name | 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[2-isocyano-6-[3-(3-methylphenyl)carbazol-9-yl]phenyl]phenyl]-3-(3-methylphenyl)carbazole |
|---|---|
| PubChem CID | 154603036 |
| Molecular Formula | C66H44N6 |
| Molecular Weight | 921.12 g/mol |
| Exact Mass | 920.36 |
| IUPAC Name | 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[2-isocyano-6-[3-(3-methylphenyl)carbazol-9-yl]phenyl]phenyl]-3-(3-methylphenyl)carbazole |
| SMILES | [C-]#[N+]c1cccc(-n2c3ccccc3c3cc(-c4cccc(C)c4)ccc32)c1-c1cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)ccc1-n1c2ccccc2c2cc(-c3cccc(C)c3)ccc21 |
| InChI | InChI=1S/C66H44N6/c1-42-17-14-23-46(37-42)48-31-34-59-53(39-48)51-25-10-12-28-57(51)71(59)61-36-33-50(66-69-64(44-19-6-4-7-20-44)68-65(70-66)45-21-8-5-9-22-45)41-55(61)63-56(67-3)27-16-30-62(63)72-58-29-13-11-26-52(58)54-40-49(32-35-60(54)72)47-24-15-18-43(2)38-47/h4-41H,1-2H3 |
| InChIKey | XMRSOJIIDIZALC-UHFFFAOYSA-N |
| XLogP | 17.24 |
| TPSA | 52.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.12 |
| LogP ≤ 5 | 17.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|