C59H40F3N3 — CID 158331682
9-[3-isocyano-2-[2-[3-(3-methylphenyl)carbazol-9-yl]-5-[2-methyl-6-(trifluoromethyl)phenyl]phenyl]phenyl]-3-(3-methylphenyl)carbazole (PubChem CID 158331682) has the molecular formula C59H40F3N3 and a molecular weight of 847.98 g/mol. Its IUPAC name is 9-[3-isocyano-2-[2-[3-(3-methylphenyl)carbazol-9-yl]-5-[2-methyl-6-(trifluoromethyl)phenyl]phenyl]phenyl]-3-(3-methylphenyl)carbazole.
| Compound Name | 9-[3-isocyano-2-[2-[3-(3-methylphenyl)carbazol-9-yl]-5-[2-methyl-6-(trifluoromethyl)phenyl]phenyl]phenyl]-3-(3-methylphenyl)carbazole |
|---|---|
| PubChem CID | 158331682 |
| Molecular Formula | C59H40F3N3 |
| Molecular Weight | 847.98 g/mol |
| Exact Mass | 847.32 |
| IUPAC Name | 9-[3-isocyano-2-[2-[3-(3-methylphenyl)carbazol-9-yl]-5-[2-methyl-6-(trifluoromethyl)phenyl]phenyl]phenyl]-3-(3-methylphenyl)carbazole |
| SMILES | [C-]#[N+]c1cccc(-n2c3ccccc3c3cc(-c4cccc(C)c4)ccc32)c1-c1cc(-c2c(C)cccc2C(F)(F)F)ccc1-n1c2ccccc2c2cc(-c3cccc(C)c3)ccc21 |
| InChI | InChI=1S/C59H40F3N3/c1-36-13-9-16-39(31-36)41-25-28-53-46(33-41)44-18-5-7-22-51(44)64(53)55-30-27-43(57-38(3)15-11-20-49(57)59(60,61)62)35-48(55)58-50(63-4)21-12-24-56(58)65-52-23-8-6-19-45(52)47-34-42(26-29-54(47)65)40-17-10-14-37(2)32-40/h5-35H,1-3H3 |
| InChIKey | PAJFNFFZRMYJCJ-UHFFFAOYSA-N |
| XLogP | 17.04 |
| TPSA | 14.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.98 |
| LogP ≤ 5 | 17.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|