C55H40F3N3 — CID 160642046
2-(3,5-dimethylphenyl)-9-[2-[2-(3,5-dimethylphenyl)carbazol-9-yl]-4-isocyano-5-[2-methyl-6-(trifluoromethyl)phenyl]phenyl]carbazole (PubChem CID 160642046) has the molecular formula C55H40F3N3 and a molecular weight of 799.94 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-9-[2-[2-(3,5-dimethylphenyl)carbazol-9-yl]-4-isocyano-5-[2-methyl-6-(trifluoromethyl)phenyl]phenyl]carbazole.
| Compound Name | 2-(3,5-dimethylphenyl)-9-[2-[2-(3,5-dimethylphenyl)carbazol-9-yl]-4-isocyano-5-[2-methyl-6-(trifluoromethyl)phenyl]phenyl]carbazole |
|---|---|
| PubChem CID | 160642046 |
| Molecular Formula | C55H40F3N3 |
| Molecular Weight | 799.94 g/mol |
| Exact Mass | 799.32 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-9-[2-[2-(3,5-dimethylphenyl)carbazol-9-yl]-4-isocyano-5-[2-methyl-6-(trifluoromethyl)phenyl]phenyl]carbazole |
| SMILES | [C-]#[N+]c1cc(-n2c3ccccc3c3ccc(-c4cc(C)cc(C)c4)cc32)c(-n2c3ccccc3c3ccc(-c4cc(C)cc(C)c4)cc32)cc1-c1c(C)cccc1C(F)(F)F |
| InChI | InChI=1S/C55H40F3N3/c1-32-22-33(2)25-39(24-32)37-18-20-43-41-13-7-9-16-48(41)60(50(43)28-37)52-30-45(54-36(5)12-11-15-46(54)55(56,57)58)47(59-6)31-53(52)61-49-17-10-8-14-42(49)44-21-19-38(29-51(44)61)40-26-34(3)23-35(4)27-40/h7-31H,1-5H3 |
| InChIKey | SHIHDMGFMYNVTE-UHFFFAOYSA-N |
| XLogP | 15.99 |
| TPSA | 14.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.94 |
| LogP ≤ 5 | 15.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|