C9H14F3NO2 — CID 140847076
2-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide (PubChem CID 140847076) has the molecular formula C9H14F3NO2 and a molecular weight of 225.21 g/mol. Its IUPAC name is 2-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide.
| Compound Name | 2-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide |
|---|---|
| PubChem CID | 140847076 |
| Molecular Formula | C9H14F3NO2 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide |
| SMILES | CCCC(=O)C(C)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H14F3NO2/c1-3-4-7(14)6(2)8(15)13-5-9(10,11)12/h6H,3-5H2,1-2H3,(H,13,15) |
| InChIKey | CKYXNAUCSGCQFA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|