C48H39NOSi — CID 140853419
N-[4-(3-methylnaphtho[2,3-b][1]benzofuran-1-yl)phenyl]-6-phenyl-N-(4-trimethylsilylphenyl)naphthalen-2-amine (PubChem CID 140853419) has the molecular formula C48H39NOSi and a molecular weight of 673.93 g/mol. Its IUPAC name is N-[4-(3-methylnaphtho[2,3-b][1]benzofuran-1-yl)phenyl]-6-phenyl-N-(4-trimethylsilylphenyl)naphthalen-2-amine.
| Compound Name | N-[4-(3-methylnaphtho[2,3-b][1]benzofuran-1-yl)phenyl]-6-phenyl-N-(4-trimethylsilylphenyl)naphthalen-2-amine |
|---|---|
| PubChem CID | 140853419 |
| Molecular Formula | C48H39NOSi |
| Molecular Weight | 673.93 g/mol |
| Exact Mass | 673.28 |
| IUPAC Name | N-[4-(3-methylnaphtho[2,3-b][1]benzofuran-1-yl)phenyl]-6-phenyl-N-(4-trimethylsilylphenyl)naphthalen-2-amine |
| SMILES | Cc1cc(-c2ccc(N(c3ccc([Si](C)(C)C)cc3)c3ccc4cc(-c5ccccc5)ccc4c3)cc2)c2c(c1)oc1cc3ccccc3cc12 |
| InChI | InChI=1S/C48H39NOSi/c1-32-26-44(48-45-30-35-12-8-9-13-36(35)31-46(45)50-47(48)27-32)34-16-19-40(20-17-34)49(41-22-24-43(25-23-41)51(2,3)4)42-21-18-38-28-37(14-15-39(38)29-42)33-10-6-5-7-11-33/h5-31H,1-4H3 |
| InChIKey | JUXGFJISZYEZJR-UHFFFAOYSA-N |
| XLogP | 13.55 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.93 |
| LogP ≤ 5 | 13.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|