C16H13F6O5S- — CID 140854859
3,3,3-trifluoro-2-(2-naphthalen-1-yloxyethoxy)-2-(trifluoromethyl)propane-1-sulfonate (PubChem CID 140854859) has the molecular formula C16H13F6O5S- and a molecular weight of 431.33 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(2-naphthalen-1-yloxyethoxy)-2-(trifluoromethyl)propane-1-sulfonate.
| Compound Name | 3,3,3-trifluoro-2-(2-naphthalen-1-yloxyethoxy)-2-(trifluoromethyl)propane-1-sulfonate |
|---|---|
| PubChem CID | 140854859 |
| Molecular Formula | C16H13F6O5S- |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | 3,3,3-trifluoro-2-(2-naphthalen-1-yloxyethoxy)-2-(trifluoromethyl)propane-1-sulfonate |
| SMILES | O=S(=O)([O-])CC(OCCOc1cccc2ccccc12)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H14F6O5S/c17-15(18,19)14(16(20,21)22,10-28(23,24)25)27-9-8-26-13-7-3-5-11-4-1-2-6-12(11)13/h1-7H,8-10H2,(H,23,24,25)/p-1 |
| InChIKey | NOWGRUAJKJICOI-UHFFFAOYSA-M |
| XLogP | 3.64 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|