About 5-fluoro-2-(4-fluoro-3H-1,2,4-triazol-2-yl)pyridine
5-fluoro-2-(4-fluoro-3H-1,2,4-triazol-2-yl)pyridine (PubChem CID 140855121) has the molecular formula C7H6F2N4
and a molecular weight of 184.15 g/mol. Its IUPAC name is 5-fluoro-2-(4-fluoro-3H-1,2,4-triazol-2-yl)pyridine.
Molecular Properties
| Compound Name | 5-fluoro-2-(4-fluoro-3H-1,2,4-triazol-2-yl)pyridine |
| PubChem CID | 140855121 |
| Molecular Formula | C7H6F2N4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 5-fluoro-2-(4-fluoro-3H-1,2,4-triazol-2-yl)pyridine |
| SMILES | Fc1ccc(N2CN(F)C=N2)nc1 |
| InChI | InChI=1S/C7H6F2N4/c8-6-1-2-7(10-3-6)13-5-12(9)4-11-13/h1-4H,5H2 |
| InChIKey | ONBOJIMJIVAYEB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 31.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-2-(4-fluoro-3H-1,2,4-triazol-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-(4-fluoro-3H-1,2,4-triazol-2-yl)pyridine?
The IUPAC name of 5-fluoro-2-(4-fluoro-3H-1,2,4-triazol-2-yl)pyridine (CID 140855121) is 5-fluoro-2-(4-fluoro-3H-1,2,4-triazol-2-yl)pyridine.
What is the SMILES notation for 5-fluoro-2-(4-fluoro-3H-1,2,4-triazol-2-yl)pyridine?
The canonical SMILES for 5-fluoro-2-(4-fluoro-3H-1,2,4-triazol-2-yl)pyridine is Fc1ccc(N2CN(F)C=N2)nc1.
What is the InChIKey of 5-fluoro-2-(4-fluoro-3H-1,2,4-triazol-2-yl)pyridine?
The InChIKey is ONBOJIMJIVAYEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F2N4/c8-6-1-2-7(10-3-6)13-5-12(9)4-11-13/h1-4H,5H2.
What are the key properties of 5-fluoro-2-(4-fluoro-3H-1,2,4-triazol-2-yl)pyridine?
5-fluoro-2-(4-fluoro-3H-1,2,4-triazol-2-yl)pyridine has a molecular weight of 184.15 g/mol, XLogP of 1.13, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-(4-fluoro-3H-1,2,4-triazol-2-yl)pyridine is sourced from PubChem (CID 140855121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).