C10H8BrFN2O2 — CID 89027480
3-bromo-1-(5-fluoro-2-pyridinyl)piperidine-2,4-dione (PubChem CID 89027480) has the molecular formula C10H8BrFN2O2 and a molecular weight of 287.09 g/mol. Its IUPAC name is 3-bromo-1-(5-fluoro-2-pyridinyl)piperidine-2,4-dione.
| Compound Name | 3-bromo-1-(5-fluoro-2-pyridinyl)piperidine-2,4-dione |
|---|---|
| PubChem CID | 89027480 |
| Molecular Formula | C10H8BrFN2O2 |
| Molecular Weight | 287.09 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 3-bromo-1-(5-fluoro-2-pyridinyl)piperidine-2,4-dione |
| SMILES | O=C1CCN(c2ccc(F)cn2)C(=O)C1Br |
| InChI | InChI=1S/C10H8BrFN2O2/c11-9-7(15)3-4-14(10(9)16)8-2-1-6(12)5-13-8/h1-2,5,9H,3-4H2 |
| InChIKey | ZRBLZAFRDFJQCZ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.09 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|